C17H16N6S — CID 2895788
4-methyl-8-prop-2-enyl-14-prop-2-enylsulfanyl-8,10,12,13,15,16-hexazatetracyclo[7.7.0.02,7.011,15]hexadeca-1(16),2(7),3,5,9,11,13-heptaene (PubChem CID 2895788) has the molecular formula C17H16N6S and a molecular weight of 336.42 g/mol. Its IUPAC name is 4-methyl-8-prop-2-enyl-14-prop-2-enylsulfanyl-8,10,12,13,15,16-hexazatetracyclo[7.7.0.02,7.011,15]hexadeca-1(16),2(7),3,5,9,11,13-heptaene.
| Compound Name | 4-methyl-8-prop-2-enyl-14-prop-2-enylsulfanyl-8,10,12,13,15,16-hexazatetracyclo[7.7.0.02,7.011,15]hexadeca-1(16),2(7),3,5,9,11,13-heptaene |
|---|---|
| PubChem CID | 2895788 |
| Molecular Formula | C17H16N6S |
| Molecular Weight | 336.42 g/mol |
| Exact Mass | 336.12 |
| IUPAC Name | 4-methyl-8-prop-2-enyl-14-prop-2-enylsulfanyl-8,10,12,13,15,16-hexazatetracyclo[7.7.0.02,7.011,15]hexadeca-1(16),2(7),3,5,9,11,13-heptaene |
| SMILES | C=CCSc1nnc2nc3c(nn12)c1cc(C)ccc1n3CC=C |
| InChI | InChI=1S/C17H16N6S/c1-4-8-22-13-7-6-11(3)10-12(13)14-15(22)18-16-19-20-17(23(16)21-14)24-9-5-2/h4-7,10H,1-2,8-9H2,3H3 |
| InChIKey | RKCRDSSCYRAMCG-UHFFFAOYSA-N |
| XLogP | 3.40 |
| TPSA | 60.90 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 336.42 |
| LogP ≤ 5 | 3.40 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|