C23H29N3O5 — CID 28959306
(3R,4R)-4-hydroxy-3-[[4-(2-methoxyethoxy)benzoyl]amino]-N-phenylazepane-1-carboxamide (PubChem CID 28959306) has the molecular formula C23H29N3O5 and a molecular weight of 427.50 g/mol. Its IUPAC name is (3R,4R)-4-hydroxy-3-[[4-(2-methoxyethoxy)benzoyl]amino]-N-phenylazepane-1-carboxamide.
| Compound Name | (3R,4R)-4-hydroxy-3-[[4-(2-methoxyethoxy)benzoyl]amino]-N-phenylazepane-1-carboxamide |
|---|---|
| PubChem CID | 28959306 |
| Molecular Formula | C23H29N3O5 |
| Molecular Weight | 427.50 g/mol |
| Exact Mass | 427.21 |
| IUPAC Name | (3R,4R)-4-hydroxy-3-[[4-(2-methoxyethoxy)benzoyl]amino]-N-phenylazepane-1-carboxamide |
| SMILES | COCCOc1ccc(C(=O)N[C@@H]2CN(C(=O)Nc3ccccc3)CCC[C@H]2O)cc1 |
| InChI | InChI=1S/C23H29N3O5/c1-30-14-15-31-19-11-9-17(10-12-19)22(28)25-20-16-26(13-5-8-21(20)27)23(29)24-18-6-3-2-4-7-18/h2-4,6-7,9-12,20-21,27H,5,8,13-16H2,1H3,(H,24,29)(H,25,28)/t20-,21-/m1/s1 |
| InChIKey | SZBQCTZIOJAHAS-NHCUHLMSSA-N |
| XLogP | 2.50 |
| TPSA | 100.13 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 31 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 427.50 |
| LogP ≤ 5 | 2.50 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|