About 2-[(3R,4S)-1-(4-fluorobenzoyl)-3-(2-piperidin-1-ylethyl)piperidin-4-yl]acetic acid
2-[(3R,4S)-1-(4-fluorobenzoyl)-3-(2-piperidin-1-ylethyl)piperidin-4-yl]acetic acid (PubChem CID 28959735) has the molecular formula C21H29FN2O3
and a molecular weight of 376.47 g/mol. Its IUPAC name is 2-[(3R,4S)-1-(4-fluorobenzoyl)-3-(2-piperidin-1-ylethyl)piperidin-4-yl]acetic acid.
Molecular Properties
| Compound Name | 2-[(3R,4S)-1-(4-fluorobenzoyl)-3-(2-piperidin-1-ylethyl)piperidin-4-yl]acetic acid |
| PubChem CID | 28959735 |
| Molecular Formula | C21H29FN2O3 |
| Molecular Weight | 376.47 g/mol |
| Exact Mass | 376.22 |
| IUPAC Name | 2-[(3R,4S)-1-(4-fluorobenzoyl)-3-(2-piperidin-1-ylethyl)piperidin-4-yl]acetic acid |
| SMILES | O=C(O)C[C@@H]1CCN(C(=O)c2ccc(F)cc2)C[C@@H]1CCN1CCCCC1 |
| InChI | InChI=1S/C21H29FN2O3/c22-19-6-4-16(5-7-19)21(27)24-13-9-17(14-20(25)26)18(15-24)8-12-23-10-2-1-3-11-23/h4-7,17-18H,1-3,8-15H2,(H,25,26)/t17-,18-/m0/s1 |
| InChIKey | OMOKDTLQZSYMAD-ROUUACIJSA-N |
| XLogP | 3.25 |
| TPSA | 60.85 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 27 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 376.47 |
| LogP ≤ 5 | 3.25 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
Analyze 2-[(3R,4S)-1-(4-fluorobenzoyl)-3-(2-piperidin-1-ylethyl)piperidin-4-yl]acetic acid with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 2-[(3R,4S)-1-(4-fluorobenzoyl)-3-(2-piperidin-1-ylethyl)piperidin-4-yl]acetic acid?
The IUPAC name of 2-[(3R,4S)-1-(4-fluorobenzoyl)-3-(2-piperidin-1-ylethyl)piperidin-4-yl]acetic acid (CID 28959735) is 2-[(3R,4S)-1-(4-fluorobenzoyl)-3-(2-piperidin-1-ylethyl)piperidin-4-yl]acetic acid.
What is the SMILES notation for 2-[(3R,4S)-1-(4-fluorobenzoyl)-3-(2-piperidin-1-ylethyl)piperidin-4-yl]acetic acid?
The canonical SMILES for 2-[(3R,4S)-1-(4-fluorobenzoyl)-3-(2-piperidin-1-ylethyl)piperidin-4-yl]acetic acid is O=C(O)C[C@@H]1CCN(C(=O)c2ccc(F)cc2)C[C@@H]1CCN1CCCCC1.
What is the InChIKey of 2-[(3R,4S)-1-(4-fluorobenzoyl)-3-(2-piperidin-1-ylethyl)piperidin-4-yl]acetic acid?
The InChIKey is OMOKDTLQZSYMAD-ROUUACIJSA-N. The full InChI is InChI=1S/C21H29FN2O3/c22-19-6-4-16(5-7-19)21(27)24-13-9-17(14-20(25)26)18(15-24)8-12-23-10-2-1-3-11-23/h4-7,17-18H,1-3,8-15H2,(H,25,26)/t17-,18-/m0/s1.
What are the key properties of 2-[(3R,4S)-1-(4-fluorobenzoyl)-3-(2-piperidin-1-ylethyl)piperidin-4-yl]acetic acid?
2-[(3R,4S)-1-(4-fluorobenzoyl)-3-(2-piperidin-1-ylethyl)piperidin-4-yl]acetic acid has a molecular weight of 376.47 g/mol, XLogP of 3.25, 6 rotatable bonds, 1 hydrogen bond donors, and 3 hydrogen bond acceptors.
Where does this data come from?
All data for 2-[(3R,4S)-1-(4-fluorobenzoyl)-3-(2-piperidin-1-ylethyl)piperidin-4-yl]acetic acid is sourced from PubChem (CID 28959735), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).