C22H27N3O3 — CID 28960225
2-[(3R,4S)-3-[[5-(4-methoxyphenyl)-1,2-oxazol-3-yl]methyl]piperidin-4-yl]-N-methyl-N-prop-2-ynylacetamide (PubChem CID 28960225) has the molecular formula C22H27N3O3 and a molecular weight of 381.48 g/mol. Its IUPAC name is 2-[(3R,4S)-3-[[5-(4-methoxyphenyl)-1,2-oxazol-3-yl]methyl]piperidin-4-yl]-N-methyl-N-prop-2-ynylacetamide.
| Compound Name | 2-[(3R,4S)-3-[[5-(4-methoxyphenyl)-1,2-oxazol-3-yl]methyl]piperidin-4-yl]-N-methyl-N-prop-2-ynylacetamide |
|---|---|
| PubChem CID | 28960225 |
| Molecular Formula | C22H27N3O3 |
| Molecular Weight | 381.48 g/mol |
| Exact Mass | 381.21 |
| IUPAC Name | 2-[(3R,4S)-3-[[5-(4-methoxyphenyl)-1,2-oxazol-3-yl]methyl]piperidin-4-yl]-N-methyl-N-prop-2-ynylacetamide |
| SMILES | C#CCN(C)C(=O)C[C@@H]1CCNC[C@@H]1Cc1cc(-c2ccc(OC)cc2)on1 |
| InChI | InChI=1S/C22H27N3O3/c1-4-11-25(2)22(26)13-17-9-10-23-15-18(17)12-19-14-21(28-24-19)16-5-7-20(27-3)8-6-16/h1,5-8,14,17-18,23H,9-13,15H2,2-3H3/t17-,18-/m0/s1 |
| InChIKey | XJXRPKLOVXUJFW-ROUUACIJSA-N |
| XLogP | 2.60 |
| TPSA | 67.60 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 28 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 381.48 |
| LogP ≤ 5 | 2.60 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'triple_bond', 'substructure': 'N/A'} |
|---|