C19H25FN4O5 — CID 28960312
1-[(1S,2S,3S,4R,5R)-4-(4-acetylpiperazin-1-yl)-3-hydroxy-6,8-dioxabicyclo[3.2.1]octan-2-yl]-3-(4-fluorophenyl)urea (PubChem CID 28960312) has the molecular formula C19H25FN4O5 and a molecular weight of 408.43 g/mol. Its IUPAC name is 1-[(1S,2S,3S,4R,5R)-4-(4-acetylpiperazin-1-yl)-3-hydroxy-6,8-dioxabicyclo[3.2.1]octan-2-yl]-3-(4-fluorophenyl)urea.
| Compound Name | 1-[(1S,2S,3S,4R,5R)-4-(4-acetylpiperazin-1-yl)-3-hydroxy-6,8-dioxabicyclo[3.2.1]octan-2-yl]-3-(4-fluorophenyl)urea |
|---|---|
| PubChem CID | 28960312 |
| Molecular Formula | C19H25FN4O5 |
| Molecular Weight | 408.43 g/mol |
| Exact Mass | 408.18 |
| IUPAC Name | 1-[(1S,2S,3S,4R,5R)-4-(4-acetylpiperazin-1-yl)-3-hydroxy-6,8-dioxabicyclo[3.2.1]octan-2-yl]-3-(4-fluorophenyl)urea |
| SMILES | CC(=O)N1CCN([C@H]2[C@@H]3OC[C@@H](O3)[C@@H](NC(=O)Nc3ccc(F)cc3)[C@@H]2O)CC1 |
| InChI | InChI=1S/C19H25FN4O5/c1-11(25)23-6-8-24(9-7-23)16-17(26)15(14-10-28-18(16)29-14)22-19(27)21-13-4-2-12(20)3-5-13/h2-5,14-18,26H,6-10H2,1H3,(H2,21,22,27)/t14-,15-,16-,17+,18-/m1/s1 |
| InChIKey | GHCXWMQVYRRTJI-HSFUPAIVSA-N |
| XLogP | -0.04 |
| TPSA | 103.37 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 29 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 408.43 |
| LogP ≤ 5 | -0.04 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 6 |