C19H27NO3S — CID 28960349
(1S,2S,3S,4R,5R)-2-(cyclohexylmethylamino)-4-phenylsulfanyl-6,8-dioxabicyclo[3.2.1]octan-3-ol (PubChem CID 28960349) has the molecular formula C19H27NO3S and a molecular weight of 349.50 g/mol. Its IUPAC name is (1S,2S,3S,4R,5R)-2-(cyclohexylmethylamino)-4-phenylsulfanyl-6,8-dioxabicyclo[3.2.1]octan-3-ol.
| Compound Name | (1S,2S,3S,4R,5R)-2-(cyclohexylmethylamino)-4-phenylsulfanyl-6,8-dioxabicyclo[3.2.1]octan-3-ol |
|---|---|
| PubChem CID | 28960349 |
| Molecular Formula | C19H27NO3S |
| Molecular Weight | 349.50 g/mol |
| Exact Mass | 349.17 |
| IUPAC Name | (1S,2S,3S,4R,5R)-2-(cyclohexylmethylamino)-4-phenylsulfanyl-6,8-dioxabicyclo[3.2.1]octan-3-ol |
| SMILES | O[C@H]1[C@H](NCC2CCCCC2)[C@H]2CO[C@H](O2)[C@@H]1Sc1ccccc1 |
| InChI | InChI=1S/C19H27NO3S/c21-17-16(20-11-13-7-3-1-4-8-13)15-12-22-19(23-15)18(17)24-14-9-5-2-6-10-14/h2,5-6,9-10,13,15-21H,1,3-4,7-8,11-12H2/t15-,16-,17+,18-,19-/m1/s1 |
| InChIKey | QKZBQZSPILHSQU-UJWQCDCRSA-N |
| XLogP | 2.80 |
| TPSA | 50.72 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 349.50 |
| LogP ≤ 5 | 2.80 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |