C19H21NO4S — CID 28960355
(1S,2S,3S,4R,5R)-2-[(2-hydroxyphenyl)methylamino]-4-phenylsulfanyl-6,8-dioxabicyclo[3.2.1]octan-3-ol (PubChem CID 28960355) has the molecular formula C19H21NO4S and a molecular weight of 359.45 g/mol. Its IUPAC name is (1S,2S,3S,4R,5R)-2-[(2-hydroxyphenyl)methylamino]-4-phenylsulfanyl-6,8-dioxabicyclo[3.2.1]octan-3-ol.
| Compound Name | (1S,2S,3S,4R,5R)-2-[(2-hydroxyphenyl)methylamino]-4-phenylsulfanyl-6,8-dioxabicyclo[3.2.1]octan-3-ol |
|---|---|
| PubChem CID | 28960355 |
| Molecular Formula | C19H21NO4S |
| Molecular Weight | 359.45 g/mol |
| Exact Mass | 359.12 |
| IUPAC Name | (1S,2S,3S,4R,5R)-2-[(2-hydroxyphenyl)methylamino]-4-phenylsulfanyl-6,8-dioxabicyclo[3.2.1]octan-3-ol |
| SMILES | Oc1ccccc1CN[C@H]1[C@H](O)[C@@H](Sc2ccccc2)[C@@H]2OC[C@H]1O2 |
| InChI | InChI=1S/C19H21NO4S/c21-14-9-5-4-6-12(14)10-20-16-15-11-23-19(24-15)18(17(16)22)25-13-7-2-1-3-8-13/h1-9,15-22H,10-11H2/t15-,16-,17+,18-,19-/m1/s1 |
| InChIKey | AGUBEXLUYDPTRA-UJWQCDCRSA-N |
| XLogP | 2.13 |
| TPSA | 70.95 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 359.45 |
| LogP ≤ 5 | 2.13 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'mannich_A(296)', 'substructure': 'N/A'} |
|---|