C25H31FN2O3 — CID 28960391
(1S,2S,3S,4R,5R)-4-(4-benzylpiperidin-1-yl)-2-[(4-fluorophenyl)methylamino]-6,8-dioxabicyclo[3.2.1]octan-3-ol (PubChem CID 28960391) has the molecular formula C25H31FN2O3 and a molecular weight of 426.53 g/mol. Its IUPAC name is (1S,2S,3S,4R,5R)-4-(4-benzylpiperidin-1-yl)-2-[(4-fluorophenyl)methylamino]-6,8-dioxabicyclo[3.2.1]octan-3-ol.
| Compound Name | (1S,2S,3S,4R,5R)-4-(4-benzylpiperidin-1-yl)-2-[(4-fluorophenyl)methylamino]-6,8-dioxabicyclo[3.2.1]octan-3-ol |
|---|---|
| PubChem CID | 28960391 |
| Molecular Formula | C25H31FN2O3 |
| Molecular Weight | 426.53 g/mol |
| Exact Mass | 426.23 |
| IUPAC Name | (1S,2S,3S,4R,5R)-4-(4-benzylpiperidin-1-yl)-2-[(4-fluorophenyl)methylamino]-6,8-dioxabicyclo[3.2.1]octan-3-ol |
| SMILES | O[C@H]1[C@H](NCc2ccc(F)cc2)[C@H]2CO[C@H](O2)[C@@H]1N1CCC(Cc2ccccc2)CC1 |
| InChI | InChI=1S/C25H31FN2O3/c26-20-8-6-19(7-9-20)15-27-22-21-16-30-25(31-21)23(24(22)29)28-12-10-18(11-13-28)14-17-4-2-1-3-5-17/h1-9,18,21-25,27,29H,10-16H2/t21-,22-,23-,24+,25-/m1/s1 |
| InChIKey | OXMTTXYWPJXZMT-UUFXTFJOSA-N |
| XLogP | 2.72 |
| TPSA | 53.96 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 31 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 426.53 |
| LogP ≤ 5 | 2.72 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |