C16H24N2O4 — CID 28960394
(1S,2S,3S,4R,5R)-2-(benzylamino)-4-(2-methoxyethylamino)-6,8-dioxabicyclo[3.2.1]octan-3-ol (PubChem CID 28960394) has the molecular formula C16H24N2O4 and a molecular weight of 308.38 g/mol. Its IUPAC name is (1S,2S,3S,4R,5R)-2-(benzylamino)-4-(2-methoxyethylamino)-6,8-dioxabicyclo[3.2.1]octan-3-ol.
| Compound Name | (1S,2S,3S,4R,5R)-2-(benzylamino)-4-(2-methoxyethylamino)-6,8-dioxabicyclo[3.2.1]octan-3-ol |
|---|---|
| PubChem CID | 28960394 |
| Molecular Formula | C16H24N2O4 |
| Molecular Weight | 308.38 g/mol |
| Exact Mass | 308.17 |
| IUPAC Name | (1S,2S,3S,4R,5R)-2-(benzylamino)-4-(2-methoxyethylamino)-6,8-dioxabicyclo[3.2.1]octan-3-ol |
| SMILES | COCCN[C@H]1[C@@H]2OC[C@@H](O2)[C@@H](NCc2ccccc2)[C@@H]1O |
| InChI | InChI=1S/C16H24N2O4/c1-20-8-7-17-14-15(19)13(12-10-21-16(14)22-12)18-9-11-5-3-2-4-6-11/h2-6,12-19H,7-10H2,1H3/t12-,13-,14-,15+,16-/m1/s1 |
| InChIKey | KTRIJBHKQFSWJE-DGXTUMSLSA-N |
| XLogP | -0.13 |
| TPSA | 71.98 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 22 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 308.38 |
| LogP ≤ 5 | -0.13 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|