C18H17FN4OS — CID 2896092
1-(2-fluorophenyl)-3-[5-(1-phenylpropyl)-1,3,4-thiadiazol-2-yl]urea (PubChem CID 2896092) has the molecular formula C18H17FN4OS and a molecular weight of 356.43 g/mol. Its IUPAC name is 1-(2-fluorophenyl)-3-[5-(1-phenylpropyl)-1,3,4-thiadiazol-2-yl]urea.
| Compound Name | 1-(2-fluorophenyl)-3-[5-(1-phenylpropyl)-1,3,4-thiadiazol-2-yl]urea |
|---|---|
| PubChem CID | 2896092 |
| Molecular Formula | C18H17FN4OS |
| Molecular Weight | 356.43 g/mol |
| Exact Mass | 356.11 |
| IUPAC Name | 1-(2-fluorophenyl)-3-[5-(1-phenylpropyl)-1,3,4-thiadiazol-2-yl]urea |
| SMILES | CCC(c1ccccc1)c1nnc(NC(=O)Nc2ccccc2F)s1 |
| InChI | InChI=1S/C18H17FN4OS/c1-2-13(12-8-4-3-5-9-12)16-22-23-18(25-16)21-17(24)20-15-11-7-6-10-14(15)19/h3-11,13H,2H2,1H3,(H2,20,21,23,24) |
| InChIKey | KGMOFGFMFGPARJ-UHFFFAOYSA-N |
| XLogP | 4.86 |
| TPSA | 66.91 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 356.43 |
| LogP ≤ 5 | 4.86 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |