C19H15BrN4O3S — CID 2896220
6-(1,3-benzodioxol-5-yl)-10-bromo-3-ethylsulfanyl-6,7-dihydro-[1,2,4]triazino[5,6-d][3,1]benzoxazepine (PubChem CID 2896220) has the molecular formula C19H15BrN4O3S and a molecular weight of 459.33 g/mol. Its IUPAC name is 6-(1,3-benzodioxol-5-yl)-10-bromo-3-ethylsulfanyl-6,7-dihydro-[1,2,4]triazino[5,6-d][3,1]benzoxazepine.
| Compound Name | 6-(1,3-benzodioxol-5-yl)-10-bromo-3-ethylsulfanyl-6,7-dihydro-[1,2,4]triazino[5,6-d][3,1]benzoxazepine |
|---|---|
| PubChem CID | 2896220 |
| Molecular Formula | C19H15BrN4O3S |
| Molecular Weight | 459.33 g/mol |
| Exact Mass | 458.00 |
| IUPAC Name | 6-(1,3-benzodioxol-5-yl)-10-bromo-3-ethylsulfanyl-6,7-dihydro-[1,2,4]triazino[5,6-d][3,1]benzoxazepine |
| SMILES | CCSc1nnc2c(n1)OC(c1ccc3c(c1)OCO3)Nc1ccc(Br)cc1-2 |
| InChI | InChI=1S/C19H15BrN4O3S/c1-2-28-19-22-18-16(23-24-19)12-8-11(20)4-5-13(12)21-17(27-18)10-3-6-14-15(7-10)26-9-25-14/h3-8,17,21H,2,9H2,1H3 |
| InChIKey | PBFAMSLRYIRECC-UHFFFAOYSA-N |
| XLogP | 4.64 |
| TPSA | 78.39 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 28 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 459.33 |
| LogP ≤ 5 | 4.64 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 8 |