C21H38N2O3 — CID 28962425
(2S)-2-[(1S,2S,4aS,7S,8S,8aS)-7-acetamido-1-hydroxy-4a,8-dimethyl-2,3,4,5,6,7,8,8a-octahydro-1H-naphthalen-2-yl]-N-tert-butylpropanamide (PubChem CID 28962425) has the molecular formula C21H38N2O3 and a molecular weight of 366.55 g/mol. Its IUPAC name is (2S)-2-[(1S,2S,4aS,7S,8S,8aS)-7-acetamido-1-hydroxy-4a,8-dimethyl-2,3,4,5,6,7,8,8a-octahydro-1H-naphthalen-2-yl]-N-tert-butylpropanamide.
| Compound Name | (2S)-2-[(1S,2S,4aS,7S,8S,8aS)-7-acetamido-1-hydroxy-4a,8-dimethyl-2,3,4,5,6,7,8,8a-octahydro-1H-naphthalen-2-yl]-N-tert-butylpropanamide |
|---|---|
| PubChem CID | 28962425 |
| Molecular Formula | C21H38N2O3 |
| Molecular Weight | 366.55 g/mol |
| Exact Mass | 366.29 |
| IUPAC Name | (2S)-2-[(1S,2S,4aS,7S,8S,8aS)-7-acetamido-1-hydroxy-4a,8-dimethyl-2,3,4,5,6,7,8,8a-octahydro-1H-naphthalen-2-yl]-N-tert-butylpropanamide |
| SMILES | CC(=O)N[C@H]1CC[C@]2(C)CC[C@@H]([C@H](C)C(=O)NC(C)(C)C)[C@H](O)[C@H]2[C@@H]1C |
| InChI | InChI=1S/C21H38N2O3/c1-12(19(26)23-20(4,5)6)15-8-10-21(7)11-9-16(22-14(3)24)13(2)17(21)18(15)25/h12-13,15-18,25H,8-11H2,1-7H3,(H,22,24)(H,23,26)/t12-,13+,15-,16-,17+,18-,21-/m0/s1 |
| InChIKey | OSNBPYDQOYZESG-AIMKKTKZSA-N |
| XLogP | 2.87 |
| TPSA | 78.43 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 366.55 |
| LogP ≤ 5 | 2.87 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 3 |