C25H38FN3O3 — CID 28963145
(2S)-2-[(1S,2S,4aS,7S,8S,8aS)-7-(ethylcarbamoylamino)-1-hydroxy-4a,8-dimethyl-2,3,4,5,6,7,8,8a-octahydro-1H-naphthalen-2-yl]-N-[(4-fluorophenyl)methyl]propanamide (PubChem CID 28963145) has the molecular formula C25H38FN3O3 and a molecular weight of 447.60 g/mol. Its IUPAC name is (2S)-2-[(1S,2S,4aS,7S,8S,8aS)-7-(ethylcarbamoylamino)-1-hydroxy-4a,8-dimethyl-2,3,4,5,6,7,8,8a-octahydro-1H-naphthalen-2-yl]-N-[(4-fluorophenyl)methyl]propanamide.
| Compound Name | (2S)-2-[(1S,2S,4aS,7S,8S,8aS)-7-(ethylcarbamoylamino)-1-hydroxy-4a,8-dimethyl-2,3,4,5,6,7,8,8a-octahydro-1H-naphthalen-2-yl]-N-[(4-fluorophenyl)methyl]propanamide |
|---|---|
| PubChem CID | 28963145 |
| Molecular Formula | C25H38FN3O3 |
| Molecular Weight | 447.60 g/mol |
| Exact Mass | 447.29 |
| IUPAC Name | (2S)-2-[(1S,2S,4aS,7S,8S,8aS)-7-(ethylcarbamoylamino)-1-hydroxy-4a,8-dimethyl-2,3,4,5,6,7,8,8a-octahydro-1H-naphthalen-2-yl]-N-[(4-fluorophenyl)methyl]propanamide |
| SMILES | CCNC(=O)N[C@H]1CC[C@]2(C)CC[C@@H]([C@H](C)C(=O)NCc3ccc(F)cc3)[C@H](O)[C@H]2[C@@H]1C |
| InChI | InChI=1S/C25H38FN3O3/c1-5-27-24(32)29-20-11-13-25(4)12-10-19(22(30)21(25)16(20)3)15(2)23(31)28-14-17-6-8-18(26)9-7-17/h6-9,15-16,19-22,30H,5,10-14H2,1-4H3,(H,28,31)(H2,27,29,32)/t15-,16+,19-,20-,21+,22-,25-/m0/s1 |
| InChIKey | RICZWJRTJRILCB-VKJOOLBJSA-N |
| XLogP | 3.59 |
| TPSA | 90.46 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 32 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 447.60 |
| LogP ≤ 5 | 3.59 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 3 |