C10H19N3O — CID 28963363
[5-(diethylamino)-1,3-dimethylpyrazol-4-yl]methanol (PubChem CID 28963363) has the molecular formula C10H19N3O and a molecular weight of 197.28 g/mol. Its IUPAC name is [5-(diethylamino)-1,3-dimethylpyrazol-4-yl]methanol.
| Compound Name | [5-(diethylamino)-1,3-dimethylpyrazol-4-yl]methanol |
|---|---|
| PubChem CID | 28963363 |
| Molecular Formula | C10H19N3O |
| Molecular Weight | 197.28 g/mol |
| Exact Mass | 197.15 |
| IUPAC Name | [5-(diethylamino)-1,3-dimethylpyrazol-4-yl]methanol |
| SMILES | CCN(CC)c1c(CO)c(C)nn1C |
| InChI | InChI=1S/C10H19N3O/c1-5-13(6-2)10-9(7-14)8(3)11-12(10)4/h14H,5-7H2,1-4H3 |
| InChIKey | VZEXOVQJGGINBU-UHFFFAOYSA-N |
| XLogP | 1.07 |
| TPSA | 41.29 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 14 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 197.28 |
| LogP ≤ 5 | 1.07 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |