About [1,3-dimethyl-5-[4-(1,3-thiazol-2-yl)piperazin-1-yl]pyrazol-4-yl]methanol
[1,3-dimethyl-5-[4-(1,3-thiazol-2-yl)piperazin-1-yl]pyrazol-4-yl]methanol (PubChem CID 28963479) has the molecular formula C13H19N5OS
and a molecular weight of 293.40 g/mol. Its IUPAC name is [1,3-dimethyl-5-[4-(1,3-thiazol-2-yl)piperazin-1-yl]pyrazol-4-yl]methanol.
Molecular Properties
| Compound Name | [1,3-dimethyl-5-[4-(1,3-thiazol-2-yl)piperazin-1-yl]pyrazol-4-yl]methanol |
| PubChem CID | 28963479 |
| Molecular Formula | C13H19N5OS |
| Molecular Weight | 293.40 g/mol |
| Exact Mass | 293.13 |
| IUPAC Name | [1,3-dimethyl-5-[4-(1,3-thiazol-2-yl)piperazin-1-yl]pyrazol-4-yl]methanol |
| SMILES | Cc1nn(C)c(N2CCN(c3nccs3)CC2)c1CO |
| InChI | InChI=1S/C13H19N5OS/c1-10-11(9-19)12(16(2)15-10)17-4-6-18(7-5-17)13-14-3-8-20-13/h3,8,19H,4-7,9H2,1-2H3 |
| InChIKey | FCTWMHXQCVIYJK-UHFFFAOYSA-N |
| XLogP | 1.00 |
| TPSA | 57.42 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 20 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 293.40 |
| LogP ≤ 5 | 1.00 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 7 |
Analyze [1,3-dimethyl-5-[4-(1,3-thiazol-2-yl)piperazin-1-yl]pyrazol-4-yl]methanol with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of [1,3-dimethyl-5-[4-(1,3-thiazol-2-yl)piperazin-1-yl]pyrazol-4-yl]methanol?
The IUPAC name of [1,3-dimethyl-5-[4-(1,3-thiazol-2-yl)piperazin-1-yl]pyrazol-4-yl]methanol (CID 28963479) is [1,3-dimethyl-5-[4-(1,3-thiazol-2-yl)piperazin-1-yl]pyrazol-4-yl]methanol.
What is the SMILES notation for [1,3-dimethyl-5-[4-(1,3-thiazol-2-yl)piperazin-1-yl]pyrazol-4-yl]methanol?
The canonical SMILES for [1,3-dimethyl-5-[4-(1,3-thiazol-2-yl)piperazin-1-yl]pyrazol-4-yl]methanol is Cc1nn(C)c(N2CCN(c3nccs3)CC2)c1CO.
What is the InChIKey of [1,3-dimethyl-5-[4-(1,3-thiazol-2-yl)piperazin-1-yl]pyrazol-4-yl]methanol?
The InChIKey is FCTWMHXQCVIYJK-UHFFFAOYSA-N. The full InChI is InChI=1S/C13H19N5OS/c1-10-11(9-19)12(16(2)15-10)17-4-6-18(7-5-17)13-14-3-8-20-13/h3,8,19H,4-7,9H2,1-2H3.
What are the key properties of [1,3-dimethyl-5-[4-(1,3-thiazol-2-yl)piperazin-1-yl]pyrazol-4-yl]methanol?
[1,3-dimethyl-5-[4-(1,3-thiazol-2-yl)piperazin-1-yl]pyrazol-4-yl]methanol has a molecular weight of 293.40 g/mol, XLogP of 1.00, 3 rotatable bonds, 1 hydrogen bond donors, and 7 hydrogen bond acceptors.
Where does this data come from?
All data for [1,3-dimethyl-5-[4-(1,3-thiazol-2-yl)piperazin-1-yl]pyrazol-4-yl]methanol is sourced from PubChem (CID 28963479), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).