About (5-imidazol-1-yl-1,3-dimethylpyrazol-4-yl)methanol
(5-imidazol-1-yl-1,3-dimethylpyrazol-4-yl)methanol (PubChem CID 28963709) has the molecular formula C9H12N4O
and a molecular weight of 192.22 g/mol. Its IUPAC name is (5-imidazol-1-yl-1,3-dimethylpyrazol-4-yl)methanol.
Molecular Properties
| Compound Name | (5-imidazol-1-yl-1,3-dimethylpyrazol-4-yl)methanol |
| PubChem CID | 28963709 |
| Molecular Formula | C9H12N4O |
| Molecular Weight | 192.22 g/mol |
| Exact Mass | 192.10 |
| IUPAC Name | (5-imidazol-1-yl-1,3-dimethylpyrazol-4-yl)methanol |
| SMILES | Cc1nn(C)c(-n2ccnc2)c1CO |
| InChI | InChI=1S/C9H12N4O/c1-7-8(5-14)9(12(2)11-7)13-4-3-10-6-13/h3-4,6,14H,5H2,1-2H3 |
| InChIKey | JCLQSADVDZCARV-UHFFFAOYSA-N |
| XLogP | 0.41 |
| TPSA | 55.87 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 14 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 192.22 |
| LogP ≤ 5 | 0.41 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
Analyze (5-imidazol-1-yl-1,3-dimethylpyrazol-4-yl)methanol with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of (5-imidazol-1-yl-1,3-dimethylpyrazol-4-yl)methanol?
The IUPAC name of (5-imidazol-1-yl-1,3-dimethylpyrazol-4-yl)methanol (CID 28963709) is (5-imidazol-1-yl-1,3-dimethylpyrazol-4-yl)methanol.
What is the SMILES notation for (5-imidazol-1-yl-1,3-dimethylpyrazol-4-yl)methanol?
The canonical SMILES for (5-imidazol-1-yl-1,3-dimethylpyrazol-4-yl)methanol is Cc1nn(C)c(-n2ccnc2)c1CO.
What is the InChIKey of (5-imidazol-1-yl-1,3-dimethylpyrazol-4-yl)methanol?
The InChIKey is JCLQSADVDZCARV-UHFFFAOYSA-N. The full InChI is InChI=1S/C9H12N4O/c1-7-8(5-14)9(12(2)11-7)13-4-3-10-6-13/h3-4,6,14H,5H2,1-2H3.
What are the key properties of (5-imidazol-1-yl-1,3-dimethylpyrazol-4-yl)methanol?
(5-imidazol-1-yl-1,3-dimethylpyrazol-4-yl)methanol has a molecular weight of 192.22 g/mol, XLogP of 0.41, 2 rotatable bonds, 1 hydrogen bond donors, and 5 hydrogen bond acceptors.
Where does this data come from?
All data for (5-imidazol-1-yl-1,3-dimethylpyrazol-4-yl)methanol is sourced from PubChem (CID 28963709), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).