C17H19N3O6S2 — CID 2896390
methyl 4-methyl-2-[(3,4,5-trimethoxybenzoyl)carbamothioylamino]-1,3-thiazole-5-carboxylate (PubChem CID 2896390) has the molecular formula C17H19N3O6S2 and a molecular weight of 425.49 g/mol. Its IUPAC name is methyl 4-methyl-2-[(3,4,5-trimethoxybenzoyl)carbamothioylamino]-1,3-thiazole-5-carboxylate.
| Compound Name | methyl 4-methyl-2-[(3,4,5-trimethoxybenzoyl)carbamothioylamino]-1,3-thiazole-5-carboxylate |
|---|---|
| PubChem CID | 2896390 |
| Molecular Formula | C17H19N3O6S2 |
| Molecular Weight | 425.49 g/mol |
| Exact Mass | 425.07 |
| IUPAC Name | methyl 4-methyl-2-[(3,4,5-trimethoxybenzoyl)carbamothioylamino]-1,3-thiazole-5-carboxylate |
| SMILES | COC(=O)c1sc(NC(=S)NC(=O)c2cc(OC)c(OC)c(OC)c2)nc1C |
| InChI | InChI=1S/C17H19N3O6S2/c1-8-13(15(22)26-5)28-17(18-8)20-16(27)19-14(21)9-6-10(23-2)12(25-4)11(7-9)24-3/h6-7H,1-5H3,(H2,18,19,20,21,27) |
| InChIKey | ASLRHQKVEGAHGN-UHFFFAOYSA-N |
| XLogP | 2.39 |
| TPSA | 108.01 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 9 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 28 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 425.49 |
| LogP ≤ 5 | 2.39 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 9 |
| Structural Alerts | {'alert_name': 'Thiocarbonyl_group', 'substructure': 'N/A'} |
|---|