C11H15ClN2O2 — CID 28964274
2-(chloromethyl)-N,N-diethyl-4-nitroaniline (PubChem CID 28964274) has the molecular formula C11H15ClN2O2 and a molecular weight of 242.71 g/mol. Its IUPAC name is 2-(chloromethyl)-N,N-diethyl-4-nitroaniline.
| Compound Name | 2-(chloromethyl)-N,N-diethyl-4-nitroaniline |
|---|---|
| PubChem CID | 28964274 |
| Molecular Formula | C11H15ClN2O2 |
| Molecular Weight | 242.71 g/mol |
| Exact Mass | 242.08 |
| IUPAC Name | 2-(chloromethyl)-N,N-diethyl-4-nitroaniline |
| SMILES | CCN(CC)c1ccc([N+](=O)[O-])cc1CCl |
| InChI | InChI=1S/C11H15ClN2O2/c1-3-13(4-2)11-6-5-10(14(15)16)7-9(11)8-12/h5-7H,3-4,8H2,1-2H3 |
| InChIKey | HWVRMPPUWVLVAY-UHFFFAOYSA-N |
| XLogP | 3.18 |
| TPSA | 46.38 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 16 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 242.71 |
| LogP ≤ 5 | 3.18 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'anil_di_alk_A(478)', 'substructure': 'N/A'}, {'alert_name': 'alkyl_halide', 'substructure': 'N/A'}, {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|