About (5-methoxy-1,3-dimethylpyrazol-4-yl)methanamine
(5-methoxy-1,3-dimethylpyrazol-4-yl)methanamine (PubChem CID 28965606) has the molecular formula C7H13N3O
and a molecular weight of 155.20 g/mol. Its IUPAC name is (5-methoxy-1,3-dimethylpyrazol-4-yl)methanamine.
Molecular Properties
| Compound Name | (5-methoxy-1,3-dimethylpyrazol-4-yl)methanamine |
| PubChem CID | 28965606 |
| Molecular Formula | C7H13N3O |
| Molecular Weight | 155.20 g/mol |
| Exact Mass | 155.11 |
| IUPAC Name | (5-methoxy-1,3-dimethylpyrazol-4-yl)methanamine |
| SMILES | COc1c(CN)c(C)nn1C |
| InChI | InChI=1S/C7H13N3O/c1-5-6(4-8)7(11-3)10(2)9-5/h4,8H2,1-3H3 |
| InChIKey | KPSCRVKNEQXWFI-UHFFFAOYSA-N |
| XLogP | 0.20 |
| TPSA | 53.07 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 11 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 155.20 |
| LogP ≤ 5 | 0.20 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
Analyze (5-methoxy-1,3-dimethylpyrazol-4-yl)methanamine with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of (5-methoxy-1,3-dimethylpyrazol-4-yl)methanamine?
The IUPAC name of (5-methoxy-1,3-dimethylpyrazol-4-yl)methanamine (CID 28965606) is (5-methoxy-1,3-dimethylpyrazol-4-yl)methanamine.
What is the SMILES notation for (5-methoxy-1,3-dimethylpyrazol-4-yl)methanamine?
The canonical SMILES for (5-methoxy-1,3-dimethylpyrazol-4-yl)methanamine is COc1c(CN)c(C)nn1C.
What is the InChIKey of (5-methoxy-1,3-dimethylpyrazol-4-yl)methanamine?
The InChIKey is KPSCRVKNEQXWFI-UHFFFAOYSA-N. The full InChI is InChI=1S/C7H13N3O/c1-5-6(4-8)7(11-3)10(2)9-5/h4,8H2,1-3H3.
What are the key properties of (5-methoxy-1,3-dimethylpyrazol-4-yl)methanamine?
(5-methoxy-1,3-dimethylpyrazol-4-yl)methanamine has a molecular weight of 155.20 g/mol, XLogP of 0.20, 2 rotatable bonds, 1 hydrogen bond donors, and 4 hydrogen bond acceptors.
Where does this data come from?
All data for (5-methoxy-1,3-dimethylpyrazol-4-yl)methanamine is sourced from PubChem (CID 28965606), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).