C15H16FNO — CID 28966023
[4-(2,4-dimethylphenoxy)-3-fluorophenyl]methanamine (PubChem CID 28966023) has the molecular formula C15H16FNO and a molecular weight of 245.30 g/mol. Its IUPAC name is [4-(2,4-dimethylphenoxy)-3-fluorophenyl]methanamine.
| Compound Name | [4-(2,4-dimethylphenoxy)-3-fluorophenyl]methanamine |
|---|---|
| PubChem CID | 28966023 |
| Molecular Formula | C15H16FNO |
| Molecular Weight | 245.30 g/mol |
| Exact Mass | 245.12 |
| IUPAC Name | [4-(2,4-dimethylphenoxy)-3-fluorophenyl]methanamine |
| SMILES | Cc1ccc(Oc2ccc(CN)cc2F)c(C)c1 |
| InChI | InChI=1S/C15H16FNO/c1-10-3-5-14(11(2)7-10)18-15-6-4-12(9-17)8-13(15)16/h3-8H,9,17H2,1-2H3 |
| InChIKey | OCYLWYRLTKNMCK-UHFFFAOYSA-N |
| XLogP | 3.69 |
| TPSA | 35.25 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 18 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 245.30 |
| LogP ≤ 5 | 3.69 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |