C13H10Cl3NO — CID 28966226
[2-chloro-6-(2,4-dichlorophenoxy)phenyl]methanamine (PubChem CID 28966226) has the molecular formula C13H10Cl3NO and a molecular weight of 302.59 g/mol. Its IUPAC name is [2-chloro-6-(2,4-dichlorophenoxy)phenyl]methanamine.
| Compound Name | [2-chloro-6-(2,4-dichlorophenoxy)phenyl]methanamine |
|---|---|
| PubChem CID | 28966226 |
| Molecular Formula | C13H10Cl3NO |
| Molecular Weight | 302.59 g/mol |
| Exact Mass | 300.98 |
| IUPAC Name | [2-chloro-6-(2,4-dichlorophenoxy)phenyl]methanamine |
| SMILES | NCc1c(Cl)cccc1Oc1ccc(Cl)cc1Cl |
| InChI | InChI=1S/C13H10Cl3NO/c14-8-4-5-13(11(16)6-8)18-12-3-1-2-10(15)9(12)7-17/h1-6H,7,17H2 |
| InChIKey | CDUFLVZWPUXNPO-UHFFFAOYSA-N |
| XLogP | 4.90 |
| TPSA | 35.25 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 18 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 302.59 |
| LogP ≤ 5 | 4.90 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |