About N-(2-chloro-4-methylphenyl)-N',N'-diethylethane-1,2-diamine
N-(2-chloro-4-methylphenyl)-N',N'-diethylethane-1,2-diamine (PubChem CID 28967872) has the molecular formula C13H21ClN2
and a molecular weight of 240.78 g/mol. Its IUPAC name is N-(2-chloro-4-methylphenyl)-N',N'-diethylethane-1,2-diamine.
Molecular Properties
| Compound Name | N-(2-chloro-4-methylphenyl)-N',N'-diethylethane-1,2-diamine |
| PubChem CID | 28967872 |
| Molecular Formula | C13H21ClN2 |
| Molecular Weight | 240.78 g/mol |
| Exact Mass | 240.14 |
| IUPAC Name | N-(2-chloro-4-methylphenyl)-N',N'-diethylethane-1,2-diamine |
| SMILES | CCN(CC)CCNc1ccc(C)cc1Cl |
| InChI | InChI=1S/C13H21ClN2/c1-4-16(5-2)9-8-15-13-7-6-11(3)10-12(13)14/h6-7,10,15H,4-5,8-9H2,1-3H3 |
| InChIKey | PAJCJAPXFJLQTH-UHFFFAOYSA-N |
| XLogP | 3.40 |
| TPSA | 15.27 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 16 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 240.78 |
| LogP ≤ 5 | 3.40 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |
Analyze N-(2-chloro-4-methylphenyl)-N',N'-diethylethane-1,2-diamine with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of N-(2-chloro-4-methylphenyl)-N',N'-diethylethane-1,2-diamine?
The IUPAC name of N-(2-chloro-4-methylphenyl)-N',N'-diethylethane-1,2-diamine (CID 28967872) is N-(2-chloro-4-methylphenyl)-N',N'-diethylethane-1,2-diamine.
What is the SMILES notation for N-(2-chloro-4-methylphenyl)-N',N'-diethylethane-1,2-diamine?
The canonical SMILES for N-(2-chloro-4-methylphenyl)-N',N'-diethylethane-1,2-diamine is CCN(CC)CCNc1ccc(C)cc1Cl.
What is the InChIKey of N-(2-chloro-4-methylphenyl)-N',N'-diethylethane-1,2-diamine?
The InChIKey is PAJCJAPXFJLQTH-UHFFFAOYSA-N. The full InChI is InChI=1S/C13H21ClN2/c1-4-16(5-2)9-8-15-13-7-6-11(3)10-12(13)14/h6-7,10,15H,4-5,8-9H2,1-3H3.
What are the key properties of N-(2-chloro-4-methylphenyl)-N',N'-diethylethane-1,2-diamine?
N-(2-chloro-4-methylphenyl)-N',N'-diethylethane-1,2-diamine has a molecular weight of 240.78 g/mol, XLogP of 3.40, 6 rotatable bonds, 1 hydrogen bond donors, and 2 hydrogen bond acceptors.
Where does this data come from?
All data for N-(2-chloro-4-methylphenyl)-N',N'-diethylethane-1,2-diamine is sourced from PubChem (CID 28967872), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).