About 2-[N-(benzenesulfonyl)-2,5-dimethoxyanilino]-N-(oxolan-2-ylmethyl)acetamide
2-[N-(benzenesulfonyl)-2,5-dimethoxyanilino]-N-(oxolan-2-ylmethyl)acetamide (PubChem CID 2897218) has the molecular formula C21H26N2O6S
and a molecular weight of 434.51 g/mol. Its IUPAC name is 2-[N-(benzenesulfonyl)-2,5-dimethoxyanilino]-N-(oxolan-2-ylmethyl)acetamide.
Molecular Properties
| Compound Name | 2-[N-(benzenesulfonyl)-2,5-dimethoxyanilino]-N-(oxolan-2-ylmethyl)acetamide |
| PubChem CID | 2897218 |
| Molecular Formula | C21H26N2O6S |
| Molecular Weight | 434.51 g/mol |
| Exact Mass | 434.15 |
| IUPAC Name | 2-[N-(benzenesulfonyl)-2,5-dimethoxyanilino]-N-(oxolan-2-ylmethyl)acetamide |
| SMILES | COc1ccc(OC)c(N(CC(=O)NCC2CCCO2)S(=O)(=O)c2ccccc2)c1 |
| InChI | InChI=1S/C21H26N2O6S/c1-27-16-10-11-20(28-2)19(13-16)23(30(25,26)18-8-4-3-5-9-18)15-21(24)22-14-17-7-6-12-29-17/h3-5,8-11,13,17H,6-7,12,14-15H2,1-2H3,(H,22,24) |
| InChIKey | ANZAEVCJXRLMIU-UHFFFAOYSA-N |
| XLogP | 2.19 |
| TPSA | 94.17 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 30 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 434.51 |
| LogP ≤ 5 | 2.19 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |
Analyze 2-[N-(benzenesulfonyl)-2,5-dimethoxyanilino]-N-(oxolan-2-ylmethyl)acetamide with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 2-[N-(benzenesulfonyl)-2,5-dimethoxyanilino]-N-(oxolan-2-ylmethyl)acetamide?
The IUPAC name of 2-[N-(benzenesulfonyl)-2,5-dimethoxyanilino]-N-(oxolan-2-ylmethyl)acetamide (CID 2897218) is 2-[N-(benzenesulfonyl)-2,5-dimethoxyanilino]-N-(oxolan-2-ylmethyl)acetamide.
What is the SMILES notation for 2-[N-(benzenesulfonyl)-2,5-dimethoxyanilino]-N-(oxolan-2-ylmethyl)acetamide?
The canonical SMILES for 2-[N-(benzenesulfonyl)-2,5-dimethoxyanilino]-N-(oxolan-2-ylmethyl)acetamide is COc1ccc(OC)c(N(CC(=O)NCC2CCCO2)S(=O)(=O)c2ccccc2)c1.
What is the InChIKey of 2-[N-(benzenesulfonyl)-2,5-dimethoxyanilino]-N-(oxolan-2-ylmethyl)acetamide?
The InChIKey is ANZAEVCJXRLMIU-UHFFFAOYSA-N. The full InChI is InChI=1S/C21H26N2O6S/c1-27-16-10-11-20(28-2)19(13-16)23(30(25,26)18-8-4-3-5-9-18)15-21(24)22-14-17-7-6-12-29-17/h3-5,8-11,13,17H,6-7,12,14-15H2,1-2H3,(H,22,24).
What are the key properties of 2-[N-(benzenesulfonyl)-2,5-dimethoxyanilino]-N-(oxolan-2-ylmethyl)acetamide?
2-[N-(benzenesulfonyl)-2,5-dimethoxyanilino]-N-(oxolan-2-ylmethyl)acetamide has a molecular weight of 434.51 g/mol, XLogP of 2.19, 9 rotatable bonds, 1 hydrogen bond donors, and 6 hydrogen bond acceptors.
Where does this data come from?
All data for 2-[N-(benzenesulfonyl)-2,5-dimethoxyanilino]-N-(oxolan-2-ylmethyl)acetamide is sourced from PubChem (CID 2897218), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).