C14H15FN4S — CID 28972774
4-[(4,5-dicyclopropyl-1,2,4-triazol-3-yl)sulfanyl]-3-fluoroaniline (PubChem CID 28972774) has the molecular formula C14H15FN4S and a molecular weight of 290.37 g/mol. Its IUPAC name is 4-[(4,5-dicyclopropyl-1,2,4-triazol-3-yl)sulfanyl]-3-fluoroaniline.
| Compound Name | 4-[(4,5-dicyclopropyl-1,2,4-triazol-3-yl)sulfanyl]-3-fluoroaniline |
|---|---|
| PubChem CID | 28972774 |
| Molecular Formula | C14H15FN4S |
| Molecular Weight | 290.37 g/mol |
| Exact Mass | 290.10 |
| IUPAC Name | 4-[(4,5-dicyclopropyl-1,2,4-triazol-3-yl)sulfanyl]-3-fluoroaniline |
| SMILES | Nc1ccc(Sc2nnc(C3CC3)n2C2CC2)c(F)c1 |
| InChI | InChI=1S/C14H15FN4S/c15-11-7-9(16)3-6-12(11)20-14-18-17-13(8-1-2-8)19(14)10-4-5-10/h3,6-8,10H,1-2,4-5,16H2 |
| InChIKey | OATSYQSOTKFSMZ-UHFFFAOYSA-N |
| XLogP | 3.36 |
| TPSA | 56.73 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 290.37 |
| LogP ≤ 5 | 3.36 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'aniline', 'substructure': 'N/A'} |
|---|