About 2,2-difluoroethylhydrazine
2,2-difluoroethylhydrazine (PubChem CID 28973204) has the molecular formula C2H6F2N2
and a molecular weight of 96.08 g/mol. Its IUPAC name is 2,2-difluoroethylhydrazine.
Molecular Properties
| Compound Name | 2,2-difluoroethylhydrazine |
| PubChem CID | 28973204 |
| Molecular Formula | C2H6F2N2 |
| Molecular Weight | 96.08 g/mol |
| Exact Mass | 96.05 |
| IUPAC Name | 2,2-difluoroethylhydrazine |
| SMILES | NNCC(F)F |
| InChI | InChI=1S/C2H6F2N2/c3-2(4)1-6-5/h2,6H,1,5H2 |
| InChIKey | YSIWOENJQAUPPK-UHFFFAOYSA-N |
| XLogP | -0.29 |
| TPSA | 38.05 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 6 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 96.08 |
| LogP ≤ 5 | -0.29 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 2 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'hydrazine', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|
Analyze 2,2-difluoroethylhydrazine with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 2,2-difluoroethylhydrazine?
The IUPAC name of 2,2-difluoroethylhydrazine (CID 28973204) is 2,2-difluoroethylhydrazine.
What is the SMILES notation for 2,2-difluoroethylhydrazine?
The canonical SMILES for 2,2-difluoroethylhydrazine is NNCC(F)F.
What is the InChIKey of 2,2-difluoroethylhydrazine?
The InChIKey is YSIWOENJQAUPPK-UHFFFAOYSA-N. The full InChI is InChI=1S/C2H6F2N2/c3-2(4)1-6-5/h2,6H,1,5H2.
What are the key properties of 2,2-difluoroethylhydrazine?
2,2-difluoroethylhydrazine has a molecular weight of 96.08 g/mol, XLogP of -0.29, 2 rotatable bonds, 2 hydrogen bond donors, and 2 hydrogen bond acceptors.
Where does this data come from?
All data for 2,2-difluoroethylhydrazine is sourced from PubChem (CID 28973204), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).