C14H13F2NO2 — CID 28974217
2-[(2,6-difluoroanilino)methyl]-4-methoxyphenol (PubChem CID 28974217) has the molecular formula C14H13F2NO2 and a molecular weight of 265.26 g/mol. Its IUPAC name is 2-[(2,6-difluoroanilino)methyl]-4-methoxyphenol.
| Compound Name | 2-[(2,6-difluoroanilino)methyl]-4-methoxyphenol |
|---|---|
| PubChem CID | 28974217 |
| Molecular Formula | C14H13F2NO2 |
| Molecular Weight | 265.26 g/mol |
| Exact Mass | 265.09 |
| IUPAC Name | 2-[(2,6-difluoroanilino)methyl]-4-methoxyphenol |
| SMILES | COc1ccc(O)c(CNc2c(F)cccc2F)c1 |
| InChI | InChI=1S/C14H13F2NO2/c1-19-10-5-6-13(18)9(7-10)8-17-14-11(15)3-2-4-12(14)16/h2-7,17-18H,8H2,1H3 |
| InChIKey | NBSKYHAGZOQMBU-UHFFFAOYSA-N |
| XLogP | 3.29 |
| TPSA | 41.49 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 265.26 |
| LogP ≤ 5 | 3.29 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'mannich_A(296)', 'substructure': 'N/A'} |
|---|