C22H25BrN2O3S — CID 2897537
N-(2-bicyclo[2.2.1]heptanyl)-2-(3-bromo-N-(4-methylphenyl)sulfonylanilino)acetamide (PubChem CID 2897537) has the molecular formula C22H25BrN2O3S and a molecular weight of 477.42 g/mol. Its IUPAC name is N-(2-bicyclo[2.2.1]heptanyl)-2-(3-bromo-N-(4-methylphenyl)sulfonylanilino)acetamide.
| Compound Name | N-(2-bicyclo[2.2.1]heptanyl)-2-(3-bromo-N-(4-methylphenyl)sulfonylanilino)acetamide |
|---|---|
| PubChem CID | 2897537 |
| Molecular Formula | C22H25BrN2O3S |
| Molecular Weight | 477.42 g/mol |
| Exact Mass | 476.08 |
| IUPAC Name | N-(2-bicyclo[2.2.1]heptanyl)-2-(3-bromo-N-(4-methylphenyl)sulfonylanilino)acetamide |
| SMILES | Cc1ccc(S(=O)(=O)N(CC(=O)NC2CC3CCC2C3)c2cccc(Br)c2)cc1 |
| InChI | InChI=1S/C22H25BrN2O3S/c1-15-5-9-20(10-6-15)29(27,28)25(19-4-2-3-18(23)13-19)14-22(26)24-21-12-16-7-8-17(21)11-16/h2-6,9-10,13,16-17,21H,7-8,11-12,14H2,1H3,(H,24,26) |
| InChIKey | WKEDETYMEKEZQR-UHFFFAOYSA-N |
| XLogP | 4.26 |
| TPSA | 66.48 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 29 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 477.42 |
| LogP ≤ 5 | 4.26 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |