C13H12INO2 — CID 28978220
4-[(2-iodoanilino)methyl]benzene-1,2-diol (PubChem CID 28978220) has the molecular formula C13H12INO2 and a molecular weight of 341.15 g/mol. Its IUPAC name is 4-[(2-iodoanilino)methyl]benzene-1,2-diol.
| Compound Name | 4-[(2-iodoanilino)methyl]benzene-1,2-diol |
|---|---|
| PubChem CID | 28978220 |
| Molecular Formula | C13H12INO2 |
| Molecular Weight | 341.15 g/mol |
| Exact Mass | 340.99 |
| IUPAC Name | 4-[(2-iodoanilino)methyl]benzene-1,2-diol |
| SMILES | Oc1ccc(CNc2ccccc2I)cc1O |
| InChI | InChI=1S/C13H12INO2/c14-10-3-1-2-4-11(10)15-8-9-5-6-12(16)13(17)7-9/h1-7,15-17H,8H2 |
| InChIKey | HOEKVSBEXTYFSB-UHFFFAOYSA-N |
| XLogP | 3.31 |
| TPSA | 52.49 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 17 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 341.15 |
| LogP ≤ 5 | 3.31 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'catechol_A(92)', 'substructure': 'N/A'}, {'alert_name': 'catechol', 'substructure': 'N/A'}, {'alert_name': 'iodine', 'substructure': 'N/A'} |
|---|