About 2-(2-iodoanilino)ethanol
2-(2-iodoanilino)ethanol (PubChem CID 28978311) has the molecular formula C8H10INO
and a molecular weight of 263.08 g/mol. Its IUPAC name is 2-(2-iodoanilino)ethanol.
Molecular Properties
| Compound Name | 2-(2-iodoanilino)ethanol |
| PubChem CID | 28978311 |
| Molecular Formula | C8H10INO |
| Molecular Weight | 263.08 g/mol |
| Exact Mass | 262.98 |
| IUPAC Name | 2-(2-iodoanilino)ethanol |
| SMILES | OCCNc1ccccc1I |
| InChI | InChI=1S/C8H10INO/c9-7-3-1-2-4-8(7)10-5-6-11/h1-4,10-11H,5-6H2 |
| InChIKey | FVPSYVGJBHOITC-UHFFFAOYSA-N |
| XLogP | 1.70 |
| TPSA | 32.26 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 11 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 263.08 |
| LogP ≤ 5 | 1.70 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 2 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'iodine', 'substructure': 'N/A'} |
|---|
Analyze 2-(2-iodoanilino)ethanol with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 2-(2-iodoanilino)ethanol?
The IUPAC name of 2-(2-iodoanilino)ethanol (CID 28978311) is 2-(2-iodoanilino)ethanol.
What is the SMILES notation for 2-(2-iodoanilino)ethanol?
The canonical SMILES for 2-(2-iodoanilino)ethanol is OCCNc1ccccc1I.
What is the InChIKey of 2-(2-iodoanilino)ethanol?
The InChIKey is FVPSYVGJBHOITC-UHFFFAOYSA-N. The full InChI is InChI=1S/C8H10INO/c9-7-3-1-2-4-8(7)10-5-6-11/h1-4,10-11H,5-6H2.
What are the key properties of 2-(2-iodoanilino)ethanol?
2-(2-iodoanilino)ethanol has a molecular weight of 263.08 g/mol, XLogP of 1.70, 3 rotatable bonds, 2 hydrogen bond donors, and 2 hydrogen bond acceptors.
Where does this data come from?
All data for 2-(2-iodoanilino)ethanol is sourced from PubChem (CID 28978311), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).