C16H12F7O3P — CID 2897885
(2,2,3,3,4,4,4-heptafluoro-1-phenylbutoxy)-phenylphosphinic acid (PubChem CID 2897885) has the molecular formula C16H12F7O3P and a molecular weight of 416.23 g/mol. Its IUPAC name is (2,2,3,3,4,4,4-heptafluoro-1-phenylbutoxy)-phenylphosphinic acid.
| Compound Name | (2,2,3,3,4,4,4-heptafluoro-1-phenylbutoxy)-phenylphosphinic acid |
|---|---|
| PubChem CID | 2897885 |
| Molecular Formula | C16H12F7O3P |
| Molecular Weight | 416.23 g/mol |
| Exact Mass | 416.04 |
| IUPAC Name | (2,2,3,3,4,4,4-heptafluoro-1-phenylbutoxy)-phenylphosphinic acid |
| SMILES | O=P(O)(OC(c1ccccc1)C(F)(F)C(F)(F)C(F)(F)F)c1ccccc1 |
| InChI | InChI=1S/C16H12F7O3P/c17-14(18,15(19,20)16(21,22)23)13(11-7-3-1-4-8-11)26-27(24,25)12-9-5-2-6-10-12/h1-10,13H,(H,24,25) |
| InChIKey | WQPHWZFYAVBLJS-UHFFFAOYSA-N |
| XLogP | 5.09 |
| TPSA | 46.53 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 27 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 416.23 |
| LogP ≤ 5 | 5.09 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'Perfluorinated_chain', 'substructure': 'N/A'}, {'alert_name': 'phosphor', 'substructure': 'N/A'} |
|---|