C12H15BrN2O3 — CID 28979309
(2R,3S)-2-[(5-bromopyridine-3-carbonyl)amino]-3-methylpentanoic acid (PubChem CID 28979309) has the molecular formula C12H15BrN2O3 and a molecular weight of 315.17 g/mol. Its IUPAC name is (2R,3S)-2-[(5-bromopyridine-3-carbonyl)amino]-3-methylpentanoic acid.
| Compound Name | (2R,3S)-2-[(5-bromopyridine-3-carbonyl)amino]-3-methylpentanoic acid |
|---|---|
| PubChem CID | 28979309 |
| Molecular Formula | C12H15BrN2O3 |
| Molecular Weight | 315.17 g/mol |
| Exact Mass | 314.03 |
| IUPAC Name | (2R,3S)-2-[(5-bromopyridine-3-carbonyl)amino]-3-methylpentanoic acid |
| SMILES | CC[C@H](C)[C@@H](NC(=O)c1cncc(Br)c1)C(=O)O |
| InChI | InChI=1S/C12H15BrN2O3/c1-3-7(2)10(12(17)18)15-11(16)8-4-9(13)6-14-5-8/h4-7,10H,3H2,1-2H3,(H,15,16)(H,17,18)/t7-,10+/m0/s1 |
| InChIKey | OQVNJVSIPVUOLL-OIBJUYFYSA-N |
| XLogP | 2.07 |
| TPSA | 79.29 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 18 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 315.17 |
| LogP ≤ 5 | 2.07 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |