About 3-pentyl-1,2-oxazol-5-amine
3-pentyl-1,2-oxazol-5-amine (PubChem CID 28980024) has the molecular formula C8H14N2O
and a molecular weight of 154.21 g/mol. Its IUPAC name is 3-pentyl-1,2-oxazol-5-amine.
Molecular Properties
| Compound Name | 3-pentyl-1,2-oxazol-5-amine |
| PubChem CID | 28980024 |
| Molecular Formula | C8H14N2O |
| Molecular Weight | 154.21 g/mol |
| Exact Mass | 154.11 |
| IUPAC Name | 3-pentyl-1,2-oxazol-5-amine |
| SMILES | CCCCCc1cc(N)on1 |
| InChI | InChI=1S/C8H14N2O/c1-2-3-4-5-7-6-8(9)11-10-7/h6H,2-5,9H2,1H3 |
| InChIKey | SWUFZCKNJXQAAH-UHFFFAOYSA-N |
| XLogP | 1.99 |
| TPSA | 52.05 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 11 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 154.21 |
| LogP ≤ 5 | 1.99 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|
Analyze 3-pentyl-1,2-oxazol-5-amine with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 3-pentyl-1,2-oxazol-5-amine?
The IUPAC name of 3-pentyl-1,2-oxazol-5-amine (CID 28980024) is 3-pentyl-1,2-oxazol-5-amine.
What is the SMILES notation for 3-pentyl-1,2-oxazol-5-amine?
The canonical SMILES for 3-pentyl-1,2-oxazol-5-amine is CCCCCc1cc(N)on1.
What is the InChIKey of 3-pentyl-1,2-oxazol-5-amine?
The InChIKey is SWUFZCKNJXQAAH-UHFFFAOYSA-N. The full InChI is InChI=1S/C8H14N2O/c1-2-3-4-5-7-6-8(9)11-10-7/h6H,2-5,9H2,1H3.
What are the key properties of 3-pentyl-1,2-oxazol-5-amine?
3-pentyl-1,2-oxazol-5-amine has a molecular weight of 154.21 g/mol, XLogP of 1.99, 4 rotatable bonds, 1 hydrogen bond donors, and 3 hydrogen bond acceptors.
Where does this data come from?
All data for 3-pentyl-1,2-oxazol-5-amine is sourced from PubChem (CID 28980024), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).