C18H15NO3 — CID 2898049
3-hydroxy-3-(2-oxo-4-phenylbut-3-enyl)-1H-indol-2-one (PubChem CID 2898049) has the molecular formula C18H15NO3 and a molecular weight of 293.32 g/mol. Its IUPAC name is 3-hydroxy-3-(2-oxo-4-phenylbut-3-enyl)-1H-indol-2-one.
| Compound Name | 3-hydroxy-3-(2-oxo-4-phenylbut-3-enyl)-1H-indol-2-one |
|---|---|
| PubChem CID | 2898049 |
| Molecular Formula | C18H15NO3 |
| Molecular Weight | 293.32 g/mol |
| Exact Mass | 293.11 |
| IUPAC Name | 3-hydroxy-3-(2-oxo-4-phenylbut-3-enyl)-1H-indol-2-one |
| SMILES | O=C(C=Cc1ccccc1)CC1(O)C(=O)Nc2ccccc21 |
| InChI | InChI=1S/C18H15NO3/c20-14(11-10-13-6-2-1-3-7-13)12-18(22)15-8-4-5-9-16(15)19-17(18)21/h1-11,22H,12H2,(H,19,21) |
| InChIKey | MZINGTHCWKKIDW-UHFFFAOYSA-N |
| XLogP | 2.50 |
| TPSA | 66.40 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 22 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 293.32 |
| LogP ≤ 5 | 2.50 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|