C20H17N3OS — CID 2898097
1-(2,4-diphenyl-3-thiophen-2-yl-3H-1,2,4-triazol-5-yl)ethanone (PubChem CID 2898097) has the molecular formula C20H17N3OS and a molecular weight of 347.44 g/mol. Its IUPAC name is 1-(2,4-diphenyl-3-thiophen-2-yl-3H-1,2,4-triazol-5-yl)ethanone.
| Compound Name | 1-(2,4-diphenyl-3-thiophen-2-yl-3H-1,2,4-triazol-5-yl)ethanone |
|---|---|
| PubChem CID | 2898097 |
| Molecular Formula | C20H17N3OS |
| Molecular Weight | 347.44 g/mol |
| Exact Mass | 347.11 |
| IUPAC Name | 1-(2,4-diphenyl-3-thiophen-2-yl-3H-1,2,4-triazol-5-yl)ethanone |
| SMILES | CC(=O)C1=NN(c2ccccc2)C(c2cccs2)N1c1ccccc1 |
| InChI | InChI=1S/C20H17N3OS/c1-15(24)19-21-23(17-11-6-3-7-12-17)20(18-13-8-14-25-18)22(19)16-9-4-2-5-10-16/h2-14,20H,1H3 |
| InChIKey | TXHNVTOGOZAUQR-UHFFFAOYSA-N |
| XLogP | 4.68 |
| TPSA | 35.91 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 347.44 |
| LogP ≤ 5 | 4.68 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |