C17H21BrN2O4S — CID 2898289
2-ethylsulfanylethyl 4-(5-bromo-2-methoxyphenyl)-6-methyl-2-oxo-3,4-dihydro-1H-pyrimidine-5-carboxylate (PubChem CID 2898289) has the molecular formula C17H21BrN2O4S and a molecular weight of 429.34 g/mol. Its IUPAC name is 2-ethylsulfanylethyl 4-(5-bromo-2-methoxyphenyl)-6-methyl-2-oxo-3,4-dihydro-1H-pyrimidine-5-carboxylate.
| Compound Name | 2-ethylsulfanylethyl 4-(5-bromo-2-methoxyphenyl)-6-methyl-2-oxo-3,4-dihydro-1H-pyrimidine-5-carboxylate |
|---|---|
| PubChem CID | 2898289 |
| Molecular Formula | C17H21BrN2O4S |
| Molecular Weight | 429.34 g/mol |
| Exact Mass | 428.04 |
| IUPAC Name | 2-ethylsulfanylethyl 4-(5-bromo-2-methoxyphenyl)-6-methyl-2-oxo-3,4-dihydro-1H-pyrimidine-5-carboxylate |
| SMILES | CCSCCOC(=O)C1=C(C)NC(=O)NC1c1cc(Br)ccc1OC |
| InChI | InChI=1S/C17H21BrN2O4S/c1-4-25-8-7-24-16(21)14-10(2)19-17(22)20-15(14)12-9-11(18)5-6-13(12)23-3/h5-6,9,15H,4,7-8H2,1-3H3,(H2,19,20,22) |
| InChIKey | FXKJNZCQZIPJDH-UHFFFAOYSA-N |
| XLogP | 3.38 |
| TPSA | 76.66 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 429.34 |
| LogP ≤ 5 | 3.38 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|