About 2-methyl-5-nitro-N,N-dipropylbenzenesulfonamide
2-methyl-5-nitro-N,N-dipropylbenzenesulfonamide (PubChem CID 2898714) has the molecular formula C13H20N2O4S
and a molecular weight of 300.38 g/mol. Its IUPAC name is 2-methyl-5-nitro-N,N-dipropylbenzenesulfonamide.
Molecular Properties
| Compound Name | 2-methyl-5-nitro-N,N-dipropylbenzenesulfonamide |
| PubChem CID | 2898714 |
| Molecular Formula | C13H20N2O4S |
| Molecular Weight | 300.38 g/mol |
| Exact Mass | 300.11 |
| IUPAC Name | 2-methyl-5-nitro-N,N-dipropylbenzenesulfonamide |
| SMILES | CCCN(CCC)S(=O)(=O)c1cc([N+](=O)[O-])ccc1C |
| InChI | InChI=1S/C13H20N2O4S/c1-4-8-14(9-5-2)20(18,19)13-10-12(15(16)17)7-6-11(13)3/h6-7,10H,4-5,8-9H2,1-3H3 |
| InChIKey | NPHOSLYVTWVVHY-UHFFFAOYSA-N |
| XLogP | 2.71 |
| TPSA | 80.52 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 20 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 300.38 |
| LogP ≤ 5 | 2.71 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|
Analyze 2-methyl-5-nitro-N,N-dipropylbenzenesulfonamide with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 2-methyl-5-nitro-N,N-dipropylbenzenesulfonamide?
The IUPAC name of 2-methyl-5-nitro-N,N-dipropylbenzenesulfonamide (CID 2898714) is 2-methyl-5-nitro-N,N-dipropylbenzenesulfonamide.
What is the SMILES notation for 2-methyl-5-nitro-N,N-dipropylbenzenesulfonamide?
The canonical SMILES for 2-methyl-5-nitro-N,N-dipropylbenzenesulfonamide is CCCN(CCC)S(=O)(=O)c1cc([N+](=O)[O-])ccc1C.
What is the InChIKey of 2-methyl-5-nitro-N,N-dipropylbenzenesulfonamide?
The InChIKey is NPHOSLYVTWVVHY-UHFFFAOYSA-N. The full InChI is InChI=1S/C13H20N2O4S/c1-4-8-14(9-5-2)20(18,19)13-10-12(15(16)17)7-6-11(13)3/h6-7,10H,4-5,8-9H2,1-3H3.
What are the key properties of 2-methyl-5-nitro-N,N-dipropylbenzenesulfonamide?
2-methyl-5-nitro-N,N-dipropylbenzenesulfonamide has a molecular weight of 300.38 g/mol, XLogP of 2.71, 7 rotatable bonds, 0 hydrogen bond donors, and 4 hydrogen bond acceptors.
Where does this data come from?
All data for 2-methyl-5-nitro-N,N-dipropylbenzenesulfonamide is sourced from PubChem (CID 2898714), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).