C19H20N2O4 — CID 2898787
(3,4-dimethylphenyl)-(2-morpholin-4-yl-5-nitrophenyl)methanone (PubChem CID 2898787) has the molecular formula C19H20N2O4 and a molecular weight of 340.38 g/mol. Its IUPAC name is (3,4-dimethylphenyl)-(2-morpholin-4-yl-5-nitrophenyl)methanone.
| Compound Name | (3,4-dimethylphenyl)-(2-morpholin-4-yl-5-nitrophenyl)methanone |
|---|---|
| PubChem CID | 2898787 |
| Molecular Formula | C19H20N2O4 |
| Molecular Weight | 340.38 g/mol |
| Exact Mass | 340.14 |
| IUPAC Name | (3,4-dimethylphenyl)-(2-morpholin-4-yl-5-nitrophenyl)methanone |
| SMILES | Cc1ccc(C(=O)c2cc([N+](=O)[O-])ccc2N2CCOCC2)cc1C |
| InChI | InChI=1S/C19H20N2O4/c1-13-3-4-15(11-14(13)2)19(22)17-12-16(21(23)24)5-6-18(17)20-7-9-25-10-8-20/h3-6,11-12H,7-10H2,1-2H3 |
| InChIKey | OAZJZBPCGMLIKT-UHFFFAOYSA-N |
| XLogP | 3.28 |
| TPSA | 72.68 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 340.38 |
| LogP ≤ 5 | 3.28 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'anil_di_alk_A(478)', 'substructure': 'N/A'}, {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|