C25H28N2O4S2 — CID 2899045
2-[N-(benzenesulfonyl)-2-methoxyanilino]-N-[2-[(4-methylphenyl)methylsulfanyl]ethyl]acetamide (PubChem CID 2899045) has the molecular formula C25H28N2O4S2 and a molecular weight of 484.64 g/mol. Its IUPAC name is 2-[N-(benzenesulfonyl)-2-methoxyanilino]-N-[2-[(4-methylphenyl)methylsulfanyl]ethyl]acetamide.
| Compound Name | 2-[N-(benzenesulfonyl)-2-methoxyanilino]-N-[2-[(4-methylphenyl)methylsulfanyl]ethyl]acetamide |
|---|---|
| PubChem CID | 2899045 |
| Molecular Formula | C25H28N2O4S2 |
| Molecular Weight | 484.64 g/mol |
| Exact Mass | 484.15 |
| IUPAC Name | 2-[N-(benzenesulfonyl)-2-methoxyanilino]-N-[2-[(4-methylphenyl)methylsulfanyl]ethyl]acetamide |
| SMILES | COc1ccccc1N(CC(=O)NCCSCc1ccc(C)cc1)S(=O)(=O)c1ccccc1 |
| InChI | InChI=1S/C25H28N2O4S2/c1-20-12-14-21(15-13-20)19-32-17-16-26-25(28)18-27(23-10-6-7-11-24(23)31-2)33(29,30)22-8-4-3-5-9-22/h3-15H,16-19H2,1-2H3,(H,26,28) |
| InChIKey | GIFWPRXWUFMOIC-UHFFFAOYSA-N |
| XLogP | 4.25 |
| TPSA | 75.71 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 11 |
| Heavy Atoms | 33 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 484.64 |
| LogP ≤ 5 | 4.25 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|