C21H30N4O4S — CID 28991419
(3aR,4R,6R,7R,7aR)-6,7-dihydroxy-3-(4-methylphenyl)-N-(2-morpholin-4-ylethyl)-2-sulfanylidene-3a,4,5,6,7,7a-hexahydro-1H-benzimidazole-4-carboxamide (PubChem CID 28991419) has the molecular formula C21H30N4O4S and a molecular weight of 434.56 g/mol. Its IUPAC name is (3aR,4R,6R,7R,7aR)-6,7-dihydroxy-3-(4-methylphenyl)-N-(2-morpholin-4-ylethyl)-2-sulfanylidene-3a,4,5,6,7,7a-hexahydro-1H-benzimidazole-4-carboxamide.
| Compound Name | (3aR,4R,6R,7R,7aR)-6,7-dihydroxy-3-(4-methylphenyl)-N-(2-morpholin-4-ylethyl)-2-sulfanylidene-3a,4,5,6,7,7a-hexahydro-1H-benzimidazole-4-carboxamide |
|---|---|
| PubChem CID | 28991419 |
| Molecular Formula | C21H30N4O4S |
| Molecular Weight | 434.56 g/mol |
| Exact Mass | 434.20 |
| IUPAC Name | (3aR,4R,6R,7R,7aR)-6,7-dihydroxy-3-(4-methylphenyl)-N-(2-morpholin-4-ylethyl)-2-sulfanylidene-3a,4,5,6,7,7a-hexahydro-1H-benzimidazole-4-carboxamide |
| SMILES | Cc1ccc(N2C(=S)N[C@H]3[C@@H](O)[C@H](O)C[C@@H](C(=O)NCCN4CCOCC4)[C@H]32)cc1 |
| InChI | InChI=1S/C21H30N4O4S/c1-13-2-4-14(5-3-13)25-18-15(12-16(26)19(27)17(18)23-21(25)30)20(28)22-6-7-24-8-10-29-11-9-24/h2-5,15-19,26-27H,6-12H2,1H3,(H,22,28)(H,23,30)/t15-,16-,17-,18-,19+/m1/s1 |
| InChIKey | AMGYCVBKXYEZDH-NNIGNNQHSA-N |
| XLogP | -0.38 |
| TPSA | 97.30 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 30 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 434.56 |
| LogP ≤ 5 | -0.38 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'Thiocarbonyl_group', 'substructure': 'N/A'} |
|---|