C18H25ClN4O3S — CID 28991427
(3aS,4R,5R,7R,7aR)-2-(4-chloroanilino)-N-[2-(dimethylamino)ethyl]-4,5-dihydroxy-3a,4,5,6,7,7a-hexahydro-1,3-benzothiazole-7-carboxamide (PubChem CID 28991427) has the molecular formula C18H25ClN4O3S and a molecular weight of 412.94 g/mol. Its IUPAC name is (3aS,4R,5R,7R,7aR)-2-(4-chloroanilino)-N-[2-(dimethylamino)ethyl]-4,5-dihydroxy-3a,4,5,6,7,7a-hexahydro-1,3-benzothiazole-7-carboxamide.
| Compound Name | (3aS,4R,5R,7R,7aR)-2-(4-chloroanilino)-N-[2-(dimethylamino)ethyl]-4,5-dihydroxy-3a,4,5,6,7,7a-hexahydro-1,3-benzothiazole-7-carboxamide |
|---|---|
| PubChem CID | 28991427 |
| Molecular Formula | C18H25ClN4O3S |
| Molecular Weight | 412.94 g/mol |
| Exact Mass | 412.13 |
| IUPAC Name | (3aS,4R,5R,7R,7aR)-2-(4-chloroanilino)-N-[2-(dimethylamino)ethyl]-4,5-dihydroxy-3a,4,5,6,7,7a-hexahydro-1,3-benzothiazole-7-carboxamide |
| SMILES | CN(C)CCNC(=O)[C@H]1C[C@@H](O)[C@H](O)[C@@H]2N=C(Nc3ccc(Cl)cc3)S[C@@H]21 |
| InChI | InChI=1S/C18H25ClN4O3S/c1-23(2)8-7-20-17(26)12-9-13(24)15(25)14-16(12)27-18(22-14)21-11-5-3-10(19)4-6-11/h3-6,12-16,24-25H,7-9H2,1-2H3,(H,20,26)(H,21,22)/t12-,13+,14-,15-,16+/m0/s1 |
| InChIKey | GOPIQDONJBIVCI-XFIYOXNOSA-N |
| XLogP | 1.01 |
| TPSA | 97.19 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 27 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 412.94 |
| LogP ≤ 5 | 1.01 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 7 |