C14H11Br3N2O — CID 28991635
4-amino-3-methyl-N-(2,4,6-tribromophenyl)benzamide (PubChem CID 28991635) has the molecular formula C14H11Br3N2O and a molecular weight of 462.97 g/mol. Its IUPAC name is 4-amino-3-methyl-N-(2,4,6-tribromophenyl)benzamide.
| Compound Name | 4-amino-3-methyl-N-(2,4,6-tribromophenyl)benzamide |
|---|---|
| PubChem CID | 28991635 |
| Molecular Formula | C14H11Br3N2O |
| Molecular Weight | 462.97 g/mol |
| Exact Mass | 459.84 |
| IUPAC Name | 4-amino-3-methyl-N-(2,4,6-tribromophenyl)benzamide |
| SMILES | Cc1cc(C(=O)Nc2c(Br)cc(Br)cc2Br)ccc1N |
| InChI | InChI=1S/C14H11Br3N2O/c1-7-4-8(2-3-12(7)18)14(20)19-13-10(16)5-9(15)6-11(13)17/h2-6H,18H2,1H3,(H,19,20) |
| InChIKey | PLRBTHCGEVIBGE-UHFFFAOYSA-N |
| XLogP | 5.12 |
| TPSA | 55.12 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 20 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 462.97 |
| LogP ≤ 5 | 5.12 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'aniline', 'substructure': 'N/A'} |
|---|