C15H14Br3NO2 — CID 28991723
2,4,6-tribromo-N-[(3,5-dimethoxyphenyl)methyl]aniline (PubChem CID 28991723) has the molecular formula C15H14Br3NO2 and a molecular weight of 479.99 g/mol. Its IUPAC name is 2,4,6-tribromo-N-[(3,5-dimethoxyphenyl)methyl]aniline.
| Compound Name | 2,4,6-tribromo-N-[(3,5-dimethoxyphenyl)methyl]aniline |
|---|---|
| PubChem CID | 28991723 |
| Molecular Formula | C15H14Br3NO2 |
| Molecular Weight | 479.99 g/mol |
| Exact Mass | 476.86 |
| IUPAC Name | 2,4,6-tribromo-N-[(3,5-dimethoxyphenyl)methyl]aniline |
| SMILES | COc1cc(CNc2c(Br)cc(Br)cc2Br)cc(OC)c1 |
| InChI | InChI=1S/C15H14Br3NO2/c1-20-11-3-9(4-12(7-11)21-2)8-19-15-13(17)5-10(16)6-14(15)18/h3-7,19H,8H2,1-2H3 |
| InChIKey | DAWDXEUOTNXSHQ-UHFFFAOYSA-N |
| XLogP | 5.60 |
| TPSA | 30.49 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 21 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 479.99 |
| LogP ≤ 5 | 5.60 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |