C12H8Cl4N2O2S — CID 28992287
3-amino-4-chloro-N-(2,4,6-trichlorophenyl)benzenesulfonamide (PubChem CID 28992287) has the molecular formula C12H8Cl4N2O2S and a molecular weight of 386.09 g/mol. Its IUPAC name is 3-amino-4-chloro-N-(2,4,6-trichlorophenyl)benzenesulfonamide.
| Compound Name | 3-amino-4-chloro-N-(2,4,6-trichlorophenyl)benzenesulfonamide |
|---|---|
| PubChem CID | 28992287 |
| Molecular Formula | C12H8Cl4N2O2S |
| Molecular Weight | 386.09 g/mol |
| Exact Mass | 383.91 |
| IUPAC Name | 3-amino-4-chloro-N-(2,4,6-trichlorophenyl)benzenesulfonamide |
| SMILES | Nc1cc(S(=O)(=O)Nc2c(Cl)cc(Cl)cc2Cl)ccc1Cl |
| InChI | InChI=1S/C12H8Cl4N2O2S/c13-6-3-9(15)12(10(16)4-6)18-21(19,20)7-1-2-8(14)11(17)5-7/h1-5,18H,17H2 |
| InChIKey | SFICODWSZONGPV-UHFFFAOYSA-N |
| XLogP | 4.68 |
| TPSA | 72.19 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 386.09 |
| LogP ≤ 5 | 4.68 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'aniline', 'substructure': 'N/A'} |
|---|