C17H12BrCl2N — CID 28993216
4-bromo-2,6-dichloro-N-(naphthalen-1-ylmethyl)aniline (PubChem CID 28993216) has the molecular formula C17H12BrCl2N and a molecular weight of 381.10 g/mol. Its IUPAC name is 4-bromo-2,6-dichloro-N-(naphthalen-1-ylmethyl)aniline.
| Compound Name | 4-bromo-2,6-dichloro-N-(naphthalen-1-ylmethyl)aniline |
|---|---|
| PubChem CID | 28993216 |
| Molecular Formula | C17H12BrCl2N |
| Molecular Weight | 381.10 g/mol |
| Exact Mass | 378.95 |
| IUPAC Name | 4-bromo-2,6-dichloro-N-(naphthalen-1-ylmethyl)aniline |
| SMILES | Clc1cc(Br)cc(Cl)c1NCc1cccc2ccccc12 |
| InChI | InChI=1S/C17H12BrCl2N/c18-13-8-15(19)17(16(20)9-13)21-10-12-6-3-5-11-4-1-2-7-14(11)12/h1-9,21H,10H2 |
| InChIKey | SBDUBZGLWSVLBP-UHFFFAOYSA-N |
| XLogP | 6.52 |
| TPSA | 12.03 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 21 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 381.10 |
| LogP ≤ 5 | 6.52 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 1 |