C8H5BrCl2F3N — CID 28993394
4-bromo-2,6-dichloro-N-(2,2,2-trifluoroethyl)aniline (PubChem CID 28993394) has the molecular formula C8H5BrCl2F3N and a molecular weight of 322.94 g/mol. Its IUPAC name is 4-bromo-2,6-dichloro-N-(2,2,2-trifluoroethyl)aniline.
| Compound Name | 4-bromo-2,6-dichloro-N-(2,2,2-trifluoroethyl)aniline |
|---|---|
| PubChem CID | 28993394 |
| Molecular Formula | C8H5BrCl2F3N |
| Molecular Weight | 322.94 g/mol |
| Exact Mass | 320.89 |
| IUPAC Name | 4-bromo-2,6-dichloro-N-(2,2,2-trifluoroethyl)aniline |
| SMILES | FC(F)(F)CNc1c(Cl)cc(Br)cc1Cl |
| InChI | InChI=1S/C8H5BrCl2F3N/c9-4-1-5(10)7(6(11)2-4)15-3-8(12,13)14/h1-2,15H,3H2 |
| InChIKey | XCXYEPANYQUXKI-UHFFFAOYSA-N |
| XLogP | 4.73 |
| TPSA | 12.03 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 15 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 322.94 |
| LogP ≤ 5 | 4.73 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 1 |