About 8-[3-(2,3,5-trimethylphenoxy)propoxy]quinoline
8-[3-(2,3,5-trimethylphenoxy)propoxy]quinoline (PubChem CID 2899461) has the molecular formula C21H23NO2
and a molecular weight of 321.42 g/mol. Its IUPAC name is 8-[3-(2,3,5-trimethylphenoxy)propoxy]quinoline.
Molecular Properties
| Compound Name | 8-[3-(2,3,5-trimethylphenoxy)propoxy]quinoline |
| PubChem CID | 2899461 |
| Molecular Formula | C21H23NO2 |
| Molecular Weight | 321.42 g/mol |
| Exact Mass | 321.17 |
| IUPAC Name | 8-[3-(2,3,5-trimethylphenoxy)propoxy]quinoline |
| SMILES | Cc1cc(C)c(C)c(OCCCOc2cccc3cccnc23)c1 |
| InChI | InChI=1S/C21H23NO2/c1-15-13-16(2)17(3)20(14-15)24-12-6-11-23-19-9-4-7-18-8-5-10-22-21(18)19/h4-5,7-10,13-14H,6,11-12H2,1-3H3 |
| InChIKey | MHORRHCMNRESSG-UHFFFAOYSA-N |
| XLogP | 5.01 |
| TPSA | 31.35 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 24 |
| Complexity | — |
Lipinski Rule of Five
1 violation
| Rule | Value |
| MW ≤ 500 | 321.42 |
| LogP ≤ 5 | 5.01 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|
Analyze 8-[3-(2,3,5-trimethylphenoxy)propoxy]quinoline with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 8-[3-(2,3,5-trimethylphenoxy)propoxy]quinoline?
The IUPAC name of 8-[3-(2,3,5-trimethylphenoxy)propoxy]quinoline (CID 2899461) is 8-[3-(2,3,5-trimethylphenoxy)propoxy]quinoline.
What is the SMILES notation for 8-[3-(2,3,5-trimethylphenoxy)propoxy]quinoline?
The canonical SMILES for 8-[3-(2,3,5-trimethylphenoxy)propoxy]quinoline is Cc1cc(C)c(C)c(OCCCOc2cccc3cccnc23)c1.
What is the InChIKey of 8-[3-(2,3,5-trimethylphenoxy)propoxy]quinoline?
The InChIKey is MHORRHCMNRESSG-UHFFFAOYSA-N. The full InChI is InChI=1S/C21H23NO2/c1-15-13-16(2)17(3)20(14-15)24-12-6-11-23-19-9-4-7-18-8-5-10-22-21(18)19/h4-5,7-10,13-14H,6,11-12H2,1-3H3.
What are the key properties of 8-[3-(2,3,5-trimethylphenoxy)propoxy]quinoline?
8-[3-(2,3,5-trimethylphenoxy)propoxy]quinoline has a molecular weight of 321.42 g/mol, XLogP of 5.01, 6 rotatable bonds, 0 hydrogen bond donors, and 3 hydrogen bond acceptors.
Where does this data come from?
All data for 8-[3-(2,3,5-trimethylphenoxy)propoxy]quinoline is sourced from PubChem (CID 2899461), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).