C16H25ClN2O2 — CID 28995438
N-(2-amino-5-chlorophenyl)-4-(4-methylpentoxy)butanamide (PubChem CID 28995438) has the molecular formula C16H25ClN2O2 and a molecular weight of 312.84 g/mol. Its IUPAC name is N-(2-amino-5-chlorophenyl)-4-(4-methylpentoxy)butanamide.
| Compound Name | N-(2-amino-5-chlorophenyl)-4-(4-methylpentoxy)butanamide |
|---|---|
| PubChem CID | 28995438 |
| Molecular Formula | C16H25ClN2O2 |
| Molecular Weight | 312.84 g/mol |
| Exact Mass | 312.16 |
| IUPAC Name | N-(2-amino-5-chlorophenyl)-4-(4-methylpentoxy)butanamide |
| SMILES | CC(C)CCCOCCCC(=O)Nc1cc(Cl)ccc1N |
| InChI | InChI=1S/C16H25ClN2O2/c1-12(2)5-3-9-21-10-4-6-16(20)19-15-11-13(17)7-8-14(15)18/h7-8,11-12H,3-6,9-10,18H2,1-2H3,(H,19,20) |
| InChIKey | HDUAPKNBJXCNOQ-UHFFFAOYSA-N |
| XLogP | 4.09 |
| TPSA | 64.35 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 312.84 |
| LogP ≤ 5 | 4.09 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'aniline', 'substructure': 'N/A'} |
|---|