C16H25ClN2O2 — CID 28995617
N-(4-amino-2-chlorophenyl)-4-hexoxybutanamide (PubChem CID 28995617) has the molecular formula C16H25ClN2O2 and a molecular weight of 312.84 g/mol. Its IUPAC name is N-(4-amino-2-chlorophenyl)-4-hexoxybutanamide.
| Compound Name | N-(4-amino-2-chlorophenyl)-4-hexoxybutanamide |
|---|---|
| PubChem CID | 28995617 |
| Molecular Formula | C16H25ClN2O2 |
| Molecular Weight | 312.84 g/mol |
| Exact Mass | 312.16 |
| IUPAC Name | N-(4-amino-2-chlorophenyl)-4-hexoxybutanamide |
| SMILES | CCCCCCOCCCC(=O)Nc1ccc(N)cc1Cl |
| InChI | InChI=1S/C16H25ClN2O2/c1-2-3-4-5-10-21-11-6-7-16(20)19-15-9-8-13(18)12-14(15)17/h8-9,12H,2-7,10-11,18H2,1H3,(H,19,20) |
| InChIKey | YAHKILDKNNHMDW-UHFFFAOYSA-N |
| XLogP | 4.24 |
| TPSA | 64.35 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 312.84 |
| LogP ≤ 5 | 4.24 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'aniline', 'substructure': 'N/A'} |
|---|