About N-(9,10-dihydrophenanthren-2-yl)acetamide
N-(9,10-dihydrophenanthren-2-yl)acetamide (PubChem CID 28996) has the molecular formula C16H15NO
and a molecular weight of 237.30 g/mol. Its IUPAC name is N-(9,10-dihydrophenanthren-2-yl)acetamide.
Molecular Properties
| Compound Name | N-(9,10-dihydrophenanthren-2-yl)acetamide |
| PubChem CID | 28996 |
| Molecular Formula | C16H15NO |
| Molecular Weight | 237.30 g/mol |
| Exact Mass | 237.12 |
| IUPAC Name | N-(9,10-dihydrophenanthren-2-yl)acetamide |
| SMILES | CC(=O)Nc1ccc2c(c1)CCc1ccccc1-2 |
| InChI | InChI=1S/C16H15NO/c1-11(18)17-14-8-9-16-13(10-14)7-6-12-4-2-3-5-15(12)16/h2-5,8-10H,6-7H2,1H3,(H,17,18) |
| InChIKey | OQLAAWHUAYKEBO-UHFFFAOYSA-N |
| XLogP | 3.41 |
| TPSA | 29.10 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 18 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 237.30 |
| LogP ≤ 5 | 3.41 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 1 |
Analyze N-(9,10-dihydrophenanthren-2-yl)acetamide with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of N-(9,10-dihydrophenanthren-2-yl)acetamide?
The IUPAC name of N-(9,10-dihydrophenanthren-2-yl)acetamide (CID 28996) is N-(9,10-dihydrophenanthren-2-yl)acetamide.
What is the SMILES notation for N-(9,10-dihydrophenanthren-2-yl)acetamide?
The canonical SMILES for N-(9,10-dihydrophenanthren-2-yl)acetamide is CC(=O)Nc1ccc2c(c1)CCc1ccccc1-2.
What is the InChIKey of N-(9,10-dihydrophenanthren-2-yl)acetamide?
The InChIKey is OQLAAWHUAYKEBO-UHFFFAOYSA-N. The full InChI is InChI=1S/C16H15NO/c1-11(18)17-14-8-9-16-13(10-14)7-6-12-4-2-3-5-15(12)16/h2-5,8-10H,6-7H2,1H3,(H,17,18).
What are the key properties of N-(9,10-dihydrophenanthren-2-yl)acetamide?
N-(9,10-dihydrophenanthren-2-yl)acetamide has a molecular weight of 237.30 g/mol, XLogP of 3.41, 1 rotatable bonds, 1 hydrogen bond donors, and 1 hydrogen bond acceptors.
Where does this data come from?
All data for N-(9,10-dihydrophenanthren-2-yl)acetamide is sourced from PubChem (CID 28996), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).