C21H26N2O4 — CID 2899982
2-(4-methylphenoxy)-N-[2-[[2-(4-methylphenoxy)acetyl]amino]propyl]acetamide (PubChem CID 2899982) has the molecular formula C21H26N2O4 and a molecular weight of 370.45 g/mol. Its IUPAC name is 2-(4-methylphenoxy)-N-[2-[[2-(4-methylphenoxy)acetyl]amino]propyl]acetamide.
| Compound Name | 2-(4-methylphenoxy)-N-[2-[[2-(4-methylphenoxy)acetyl]amino]propyl]acetamide |
|---|---|
| PubChem CID | 2899982 |
| Molecular Formula | C21H26N2O4 |
| Molecular Weight | 370.45 g/mol |
| Exact Mass | 370.19 |
| IUPAC Name | 2-(4-methylphenoxy)-N-[2-[[2-(4-methylphenoxy)acetyl]amino]propyl]acetamide |
| SMILES | Cc1ccc(OCC(=O)NCC(C)NC(=O)COc2ccc(C)cc2)cc1 |
| InChI | InChI=1S/C21H26N2O4/c1-15-4-8-18(9-5-15)26-13-20(24)22-12-17(3)23-21(25)14-27-19-10-6-16(2)7-11-19/h4-11,17H,12-14H2,1-3H3,(H,22,24)(H,23,25) |
| InChIKey | SOZNSFROCCBRNR-UHFFFAOYSA-N |
| XLogP | 2.38 |
| TPSA | 76.66 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 27 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 370.45 |
| LogP ≤ 5 | 2.38 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |